C10H15NO2S — CID 130644818
(3-methyl-1,2-thiazol-5-yl)-(oxan-3-yl)methanol (PubChem CID 130644818) has the molecular formula C10H15NO2S and a molecular weight of 213.30 g/mol. Its IUPAC name is (3-methyl-1,2-thiazol-5-yl)-(oxan-3-yl)methanol.
| Compound Name | (3-methyl-1,2-thiazol-5-yl)-(oxan-3-yl)methanol |
|---|---|
| PubChem CID | 130644818 |
| Molecular Formula | C10H15NO2S |
| Molecular Weight | 213.30 g/mol |
| Exact Mass | 213.08 |
| IUPAC Name | (3-methyl-1,2-thiazol-5-yl)-(oxan-3-yl)methanol |
| SMILES | Cc1cc(C(O)C2CCCOC2)sn1 |
| InChI | InChI=1S/C10H15NO2S/c1-7-5-9(14-11-7)10(12)8-3-2-4-13-6-8/h5,8,10,12H,2-4,6H2,1H3 |
| InChIKey | LDCHKVINEHCJHD-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.30 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |