C9H15NOS — CID 130646530
2-methyl-1-(3-methyl-1,2-thiazol-5-yl)butan-1-ol (PubChem CID 130646530) has the molecular formula C9H15NOS and a molecular weight of 185.29 g/mol. Its IUPAC name is 2-methyl-1-(3-methyl-1,2-thiazol-5-yl)butan-1-ol.
| Compound Name | 2-methyl-1-(3-methyl-1,2-thiazol-5-yl)butan-1-ol |
|---|---|
| PubChem CID | 130646530 |
| Molecular Formula | C9H15NOS |
| Molecular Weight | 185.29 g/mol |
| Exact Mass | 185.09 |
| IUPAC Name | 2-methyl-1-(3-methyl-1,2-thiazol-5-yl)butan-1-ol |
| SMILES | CCC(C)C(O)c1cc(C)ns1 |
| InChI | InChI=1S/C9H15NOS/c1-4-6(2)9(11)8-5-7(3)10-12-8/h5-6,9,11H,4H2,1-3H3 |
| InChIKey | BJSRYUIDZOYBNQ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.29 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |