C8H6FN3S2 — CID 130649775
5-fluoro-6-(3-methyl-1,2-thiazol-5-yl)-1H-pyrimidine-2-thione (PubChem CID 130649775) has the molecular formula C8H6FN3S2 and a molecular weight of 227.29 g/mol. Its IUPAC name is 5-fluoro-6-(3-methyl-1,2-thiazol-5-yl)-1H-pyrimidine-2-thione.
| Compound Name | 5-fluoro-6-(3-methyl-1,2-thiazol-5-yl)-1H-pyrimidine-2-thione |
|---|---|
| PubChem CID | 130649775 |
| Molecular Formula | C8H6FN3S2 |
| Molecular Weight | 227.29 g/mol |
| Exact Mass | 227.00 |
| IUPAC Name | 5-fluoro-6-(3-methyl-1,2-thiazol-5-yl)-1H-pyrimidine-2-thione |
| SMILES | Cc1cc(-c2[nH]c(=S)ncc2F)sn1 |
| InChI | InChI=1S/C8H6FN3S2/c1-4-2-6(14-12-4)7-5(9)3-10-8(13)11-7/h2-3H,1H3,(H,10,11,13) |
| InChIKey | WEUOZQNMHMYFRJ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.29 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|