C9H6F2N2S — CID 118004986
5,6-difluoro-3-methyl-1H-1,8-naphthyridine-2-thione (PubChem CID 118004986) has the molecular formula C9H6F2N2S and a molecular weight of 212.22 g/mol. Its IUPAC name is 5,6-difluoro-3-methyl-1H-1,8-naphthyridine-2-thione.
| Compound Name | 5,6-difluoro-3-methyl-1H-1,8-naphthyridine-2-thione |
|---|---|
| PubChem CID | 118004986 |
| Molecular Formula | C9H6F2N2S |
| Molecular Weight | 212.22 g/mol |
| Exact Mass | 212.02 |
| IUPAC Name | 5,6-difluoro-3-methyl-1H-1,8-naphthyridine-2-thione |
| SMILES | Cc1cc2c(F)c(F)cnc2[nH]c1=S |
| InChI | InChI=1S/C9H6F2N2S/c1-4-2-5-7(11)6(10)3-12-8(5)13-9(4)14/h2-3H,1H3,(H,12,13,14) |
| InChIKey | UZQBIVUFNVOBFE-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.22 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|