C7H5FN2S2 — CID 139355842
6-fluoro-7-methyl-3H-[1,3]thiazolo[4,5-b]pyridine-2-thione (PubChem CID 139355842) has the molecular formula C7H5FN2S2 and a molecular weight of 200.26 g/mol. Its IUPAC name is 6-fluoro-7-methyl-3H-[1,3]thiazolo[4,5-b]pyridine-2-thione.
| Compound Name | 6-fluoro-7-methyl-3H-[1,3]thiazolo[4,5-b]pyridine-2-thione |
|---|---|
| PubChem CID | 139355842 |
| Molecular Formula | C7H5FN2S2 |
| Molecular Weight | 200.26 g/mol |
| Exact Mass | 199.99 |
| IUPAC Name | 6-fluoro-7-methyl-3H-[1,3]thiazolo[4,5-b]pyridine-2-thione |
| SMILES | Cc1c(F)cnc2[nH]c(=S)sc12 |
| InChI | InChI=1S/C7H5FN2S2/c1-3-4(8)2-9-6-5(3)12-7(11)10-6/h2H,1H3,(H,9,10,11) |
| InChIKey | BRUWXRRWPLHENV-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.26 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|