About 3-methyl-5-(3-methyl-1,2-thiazol-5-yl)-1,2-thiazole
3-methyl-5-(3-methyl-1,2-thiazol-5-yl)-1,2-thiazole (PubChem CID 134094530) has the molecular formula C8H8N2S2
and a molecular weight of 196.30 g/mol. Its IUPAC name is 3-methyl-5-(3-methyl-1,2-thiazol-5-yl)-1,2-thiazole.
Analyze 3-methyl-5-(3-methyl-1,2-thiazol-5-yl)-1,2-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-5-(3-methyl-1,2-thiazol-5-yl)-1,2-thiazole?
The IUPAC name of 3-methyl-5-(3-methyl-1,2-thiazol-5-yl)-1,2-thiazole (CID 134094530) is 3-methyl-5-(3-methyl-1,2-thiazol-5-yl)-1,2-thiazole.
What is the SMILES notation for 3-methyl-5-(3-methyl-1,2-thiazol-5-yl)-1,2-thiazole?
The canonical SMILES for 3-methyl-5-(3-methyl-1,2-thiazol-5-yl)-1,2-thiazole is Cc1cc(-c2cc(C)ns2)sn1.
What is the InChIKey of 3-methyl-5-(3-methyl-1,2-thiazol-5-yl)-1,2-thiazole?
The InChIKey is VWZQISBUXDLLDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2S2/c1-5-3-7(11-9-5)8-4-6(2)10-12-8/h3-4H,1-2H3.
What are the key properties of 3-methyl-5-(3-methyl-1,2-thiazol-5-yl)-1,2-thiazole?
3-methyl-5-(3-methyl-1,2-thiazol-5-yl)-1,2-thiazole has a molecular weight of 196.30 g/mol, XLogP of 2.88, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-5-(3-methyl-1,2-thiazol-5-yl)-1,2-thiazole is sourced from PubChem (CID 134094530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).