C7H7N5S — CID 82402081
5-(3-methyl-1,2-thiazol-5-yl)-1,2,4-triazin-3-amine (PubChem CID 82402081) has the molecular formula C7H7N5S and a molecular weight of 193.24 g/mol. Its IUPAC name is 5-(3-methyl-1,2-thiazol-5-yl)-1,2,4-triazin-3-amine.
| Compound Name | 5-(3-methyl-1,2-thiazol-5-yl)-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 82402081 |
| Molecular Formula | C7H7N5S |
| Molecular Weight | 193.24 g/mol |
| Exact Mass | 193.04 |
| IUPAC Name | 5-(3-methyl-1,2-thiazol-5-yl)-1,2,4-triazin-3-amine |
| SMILES | Cc1cc(-c2cnnc(N)n2)sn1 |
| InChI | InChI=1S/C7H7N5S/c1-4-2-6(13-12-4)5-3-9-11-7(8)10-5/h2-3H,1H3,(H2,8,10,11) |
| InChIKey | XQEPXBDAPNEBFK-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 77.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.24 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |