C8H7N5 — CID 43134555
5-pyridin-2-yl-1,2,4-triazin-3-amine (PubChem CID 43134555) has the molecular formula C8H7N5 and a molecular weight of 173.18 g/mol. Its IUPAC name is 5-pyridin-2-yl-1,2,4-triazin-3-amine.
| Compound Name | 5-pyridin-2-yl-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 43134555 |
| Molecular Formula | C8H7N5 |
| Molecular Weight | 173.18 g/mol |
| Exact Mass | 173.07 |
| IUPAC Name | 5-pyridin-2-yl-1,2,4-triazin-3-amine |
| SMILES | Nc1nncc(-c2ccccn2)n1 |
| InChI | InChI=1S/C8H7N5/c9-8-12-7(5-11-13-8)6-3-1-2-4-10-6/h1-5H,(H2,9,12,13) |
| InChIKey | XJDTYGOOBZQYAR-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 77.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.18 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |