C14H10N4 — CID 19065735
3,5-dipyridin-2-ylpyridazine (PubChem CID 19065735) has the molecular formula C14H10N4 and a molecular weight of 234.26 g/mol. Its IUPAC name is 3,5-dipyridin-2-ylpyridazine.
| Compound Name | 3,5-dipyridin-2-ylpyridazine |
|---|---|
| PubChem CID | 19065735 |
| Molecular Formula | C14H10N4 |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 3,5-dipyridin-2-ylpyridazine |
| SMILES | c1ccc(-c2cnnc(-c3ccccn3)c2)nc1 |
| InChI | InChI=1S/C14H10N4/c1-3-7-15-12(5-1)11-9-14(18-17-10-11)13-6-2-4-8-16-13/h1-10H |
| InChIKey | WSFPTZFEKVCBEU-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |