C14H18N4 — CID 82477837
5-(4-tert-butyl-2-methylphenyl)-1,2,4-triazin-3-amine (PubChem CID 82477837) has the molecular formula C14H18N4 and a molecular weight of 242.33 g/mol. Its IUPAC name is 5-(4-tert-butyl-2-methylphenyl)-1,2,4-triazin-3-amine.
| Compound Name | 5-(4-tert-butyl-2-methylphenyl)-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 82477837 |
| Molecular Formula | C14H18N4 |
| Molecular Weight | 242.33 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | 5-(4-tert-butyl-2-methylphenyl)-1,2,4-triazin-3-amine |
| SMILES | Cc1cc(C(C)(C)C)ccc1-c1cnnc(N)n1 |
| InChI | InChI=1S/C14H18N4/c1-9-7-10(14(2,3)4)5-6-11(9)12-8-16-18-13(15)17-12/h5-8H,1-4H3,(H2,15,17,18) |
| InChIKey | HPFNCXINXMERHX-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.33 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |