C8H9N5S — CID 130752211
6-(3-methyl-1,2-thiazol-5-yl)pyrimidine-2,4-diamine (PubChem CID 130752211) has the molecular formula C8H9N5S and a molecular weight of 207.26 g/mol. Its IUPAC name is 6-(3-methyl-1,2-thiazol-5-yl)pyrimidine-2,4-diamine.
| Compound Name | 6-(3-methyl-1,2-thiazol-5-yl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 130752211 |
| Molecular Formula | C8H9N5S |
| Molecular Weight | 207.26 g/mol |
| Exact Mass | 207.06 |
| IUPAC Name | 6-(3-methyl-1,2-thiazol-5-yl)pyrimidine-2,4-diamine |
| SMILES | Cc1cc(-c2cc(N)nc(N)n2)sn1 |
| InChI | InChI=1S/C8H9N5S/c1-4-2-6(14-13-4)5-3-7(9)12-8(10)11-5/h2-3H,1H3,(H4,9,10,11,12) |
| InChIKey | LSZUDTRVITVCFS-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 90.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.26 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |