About 5-(5-bromo-1,3,4-thiadiazol-2-yl)-2-oxa-5-azabicyclo[2.2.1]heptane
5-(5-bromo-1,3,4-thiadiazol-2-yl)-2-oxa-5-azabicyclo[2.2.1]heptane (PubChem CID 130660302) has the molecular formula C7H8BrN3OS
and a molecular weight of 262.13 g/mol. Its IUPAC name is 5-(5-bromo-1,3,4-thiadiazol-2-yl)-2-oxa-5-azabicyclo[2.2.1]heptane.
Molecular Properties
| Compound Name | 5-(5-bromo-1,3,4-thiadiazol-2-yl)-2-oxa-5-azabicyclo[2.2.1]heptane |
| PubChem CID | 130660302 |
| Molecular Formula | C7H8BrN3OS |
| Molecular Weight | 262.13 g/mol |
| Exact Mass | 260.96 |
| IUPAC Name | 5-(5-bromo-1,3,4-thiadiazol-2-yl)-2-oxa-5-azabicyclo[2.2.1]heptane |
| SMILES | Brc1nnc(N2CC3CC2CO3)s1 |
| InChI | InChI=1S/C7H8BrN3OS/c8-6-9-10-7(13-6)11-2-5-1-4(11)3-12-5/h4-5H,1-3H2 |
| InChIKey | VDWBDXDARORXBO-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.13 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(5-bromo-1,3,4-thiadiazol-2-yl)-2-oxa-5-azabicyclo[2.2.1]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(5-bromo-1,3,4-thiadiazol-2-yl)-2-oxa-5-azabicyclo[2.2.1]heptane?
The IUPAC name of 5-(5-bromo-1,3,4-thiadiazol-2-yl)-2-oxa-5-azabicyclo[2.2.1]heptane (CID 130660302) is 5-(5-bromo-1,3,4-thiadiazol-2-yl)-2-oxa-5-azabicyclo[2.2.1]heptane.
What is the SMILES notation for 5-(5-bromo-1,3,4-thiadiazol-2-yl)-2-oxa-5-azabicyclo[2.2.1]heptane?
The canonical SMILES for 5-(5-bromo-1,3,4-thiadiazol-2-yl)-2-oxa-5-azabicyclo[2.2.1]heptane is Brc1nnc(N2CC3CC2CO3)s1.
What is the InChIKey of 5-(5-bromo-1,3,4-thiadiazol-2-yl)-2-oxa-5-azabicyclo[2.2.1]heptane?
The InChIKey is VDWBDXDARORXBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8BrN3OS/c8-6-9-10-7(13-6)11-2-5-1-4(11)3-12-5/h4-5H,1-3H2.
What are the key properties of 5-(5-bromo-1,3,4-thiadiazol-2-yl)-2-oxa-5-azabicyclo[2.2.1]heptane?
5-(5-bromo-1,3,4-thiadiazol-2-yl)-2-oxa-5-azabicyclo[2.2.1]heptane has a molecular weight of 262.13 g/mol, XLogP of 1.28, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(5-bromo-1,3,4-thiadiazol-2-yl)-2-oxa-5-azabicyclo[2.2.1]heptane is sourced from PubChem (CID 130660302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).