C12H19NO — CID 130666373
2-[(2S)-2-aminobutan-2-yl]-4,6-dimethylphenol (PubChem CID 130666373) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is 2-[(2S)-2-aminobutan-2-yl]-4,6-dimethylphenol.
| Compound Name | 2-[(2S)-2-aminobutan-2-yl]-4,6-dimethylphenol |
|---|---|
| PubChem CID | 130666373 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | 2-[(2S)-2-aminobutan-2-yl]-4,6-dimethylphenol |
| SMILES | CC[C@](C)(N)c1cc(C)cc(C)c1O |
| InChI | InChI=1S/C12H19NO/c1-5-12(4,13)10-7-8(2)6-9(3)11(10)14/h6-7,14H,5,13H2,1-4H3/t12-/m0/s1 |
| InChIKey | WCBHQBYFNKQDDL-LBPRGKRZSA-N |
| XLogP | 2.59 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|