About N-(2-bromoprop-2-enyl)-1H-pyrrolo[2,3-c]pyridin-5-amine
N-(2-bromoprop-2-enyl)-1H-pyrrolo[2,3-c]pyridin-5-amine (PubChem CID 130667288) has the molecular formula C10H10BrN3
and a molecular weight of 252.11 g/mol. Its IUPAC name is N-(2-bromoprop-2-enyl)-1H-pyrrolo[2,3-c]pyridin-5-amine.
Molecular Properties
| Compound Name | N-(2-bromoprop-2-enyl)-1H-pyrrolo[2,3-c]pyridin-5-amine |
| PubChem CID | 130667288 |
| Molecular Formula | C10H10BrN3 |
| Molecular Weight | 252.11 g/mol |
| Exact Mass | 251.01 |
| IUPAC Name | N-(2-bromoprop-2-enyl)-1H-pyrrolo[2,3-c]pyridin-5-amine |
| SMILES | C=C(Br)CNc1cc2cc[nH]c2cn1 |
| InChI | InChI=1S/C10H10BrN3/c1-7(11)5-13-10-4-8-2-3-12-9(8)6-14-10/h2-4,6,12H,1,5H2,(H,13,14) |
| InChIKey | CSKPFCANHZDHKK-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.11 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(2-bromoprop-2-enyl)-1H-pyrrolo[2,3-c]pyridin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-bromoprop-2-enyl)-1H-pyrrolo[2,3-c]pyridin-5-amine?
The IUPAC name of N-(2-bromoprop-2-enyl)-1H-pyrrolo[2,3-c]pyridin-5-amine (CID 130667288) is N-(2-bromoprop-2-enyl)-1H-pyrrolo[2,3-c]pyridin-5-amine.
What is the SMILES notation for N-(2-bromoprop-2-enyl)-1H-pyrrolo[2,3-c]pyridin-5-amine?
The canonical SMILES for N-(2-bromoprop-2-enyl)-1H-pyrrolo[2,3-c]pyridin-5-amine is C=C(Br)CNc1cc2cc[nH]c2cn1.
What is the InChIKey of N-(2-bromoprop-2-enyl)-1H-pyrrolo[2,3-c]pyridin-5-amine?
The InChIKey is CSKPFCANHZDHKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10BrN3/c1-7(11)5-13-10-4-8-2-3-12-9(8)6-14-10/h2-4,6,12H,1,5H2,(H,13,14).
What are the key properties of N-(2-bromoprop-2-enyl)-1H-pyrrolo[2,3-c]pyridin-5-amine?
N-(2-bromoprop-2-enyl)-1H-pyrrolo[2,3-c]pyridin-5-amine has a molecular weight of 252.11 g/mol, XLogP of 2.88, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-bromoprop-2-enyl)-1H-pyrrolo[2,3-c]pyridin-5-amine is sourced from PubChem (CID 130667288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).