C9H12N2O2 — CID 130669927
N-(1-cyanopropan-2-yl)-2,3-dihydrofuran-5-carboxamide (PubChem CID 130669927) has the molecular formula C9H12N2O2 and a molecular weight of 180.21 g/mol. Its IUPAC name is N-(1-cyanopropan-2-yl)-2,3-dihydrofuran-5-carboxamide.
| Compound Name | N-(1-cyanopropan-2-yl)-2,3-dihydrofuran-5-carboxamide |
|---|---|
| PubChem CID | 130669927 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | N-(1-cyanopropan-2-yl)-2,3-dihydrofuran-5-carboxamide |
| SMILES | CC(CC#N)NC(=O)C1=CCCO1 |
| InChI | InChI=1S/C9H12N2O2/c1-7(4-5-10)11-9(12)8-3-2-6-13-8/h3,7H,2,4,6H2,1H3,(H,11,12) |
| InChIKey | WDLZFAABYGTLIP-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |