C6H11Cl2N3O2 — CID 130675904
1-(2,2-dichloropropanoylamino)-3-ethylurea (PubChem CID 130675904) has the molecular formula C6H11Cl2N3O2 and a molecular weight of 228.08 g/mol. Its IUPAC name is 1-(2,2-dichloropropanoylamino)-3-ethylurea.
| Compound Name | 1-(2,2-dichloropropanoylamino)-3-ethylurea |
|---|---|
| PubChem CID | 130675904 |
| Molecular Formula | C6H11Cl2N3O2 |
| Molecular Weight | 228.08 g/mol |
| Exact Mass | 227.02 |
| IUPAC Name | 1-(2,2-dichloropropanoylamino)-3-ethylurea |
| SMILES | CCNC(=O)NNC(=O)C(C)(Cl)Cl |
| InChI | InChI=1S/C6H11Cl2N3O2/c1-3-9-5(13)11-10-4(12)6(2,7)8/h3H2,1-2H3,(H,10,12)(H2,9,11,13) |
| InChIKey | CDICZPVGIHLYPU-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.08 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|