C8H12Cl2N2O — CID 130677729
diazinan-1-yl-(2,2-dichlorocyclopropyl)methanone (PubChem CID 130677729) has the molecular formula C8H12Cl2N2O and a molecular weight of 223.10 g/mol. Its IUPAC name is diazinan-1-yl-(2,2-dichlorocyclopropyl)methanone.
| Compound Name | diazinan-1-yl-(2,2-dichlorocyclopropyl)methanone |
|---|---|
| PubChem CID | 130677729 |
| Molecular Formula | C8H12Cl2N2O |
| Molecular Weight | 223.10 g/mol |
| Exact Mass | 222.03 |
| IUPAC Name | diazinan-1-yl-(2,2-dichlorocyclopropyl)methanone |
| SMILES | O=C(C1CC1(Cl)Cl)N1CCCCN1 |
| InChI | InChI=1S/C8H12Cl2N2O/c9-8(10)5-6(8)7(13)12-4-2-1-3-11-12/h6,11H,1-5H2 |
| InChIKey | LHKJRFKFWHVDNW-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.10 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|