C9H7ClN2O3 — CID 130682459
6-chloro-2-(prop-2-ynoxyamino)pyridine-3-carboxylic acid (PubChem CID 130682459) has the molecular formula C9H7ClN2O3 and a molecular weight of 226.62 g/mol. Its IUPAC name is 6-chloro-2-(prop-2-ynoxyamino)pyridine-3-carboxylic acid.
| Compound Name | 6-chloro-2-(prop-2-ynoxyamino)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 130682459 |
| Molecular Formula | C9H7ClN2O3 |
| Molecular Weight | 226.62 g/mol |
| Exact Mass | 226.01 |
| IUPAC Name | 6-chloro-2-(prop-2-ynoxyamino)pyridine-3-carboxylic acid |
| SMILES | C#CCONc1nc(Cl)ccc1C(=O)O |
| InChI | InChI=1S/C9H7ClN2O3/c1-2-5-15-12-8-6(9(13)14)3-4-7(10)11-8/h1,3-4H,5H2,(H,11,12)(H,13,14) |
| InChIKey | MTWIHHXUBUCHKN-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.62 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|