C7H11N3OS — CID 130685476
1-ethyl-3-(2-methyl-1,3-thiazol-5-yl)urea (PubChem CID 130685476) has the molecular formula C7H11N3OS and a molecular weight of 185.25 g/mol. Its IUPAC name is 1-ethyl-3-(2-methyl-1,3-thiazol-5-yl)urea.
| Compound Name | 1-ethyl-3-(2-methyl-1,3-thiazol-5-yl)urea |
|---|---|
| PubChem CID | 130685476 |
| Molecular Formula | C7H11N3OS |
| Molecular Weight | 185.25 g/mol |
| Exact Mass | 185.06 |
| IUPAC Name | 1-ethyl-3-(2-methyl-1,3-thiazol-5-yl)urea |
| SMILES | CCNC(=O)Nc1cnc(C)s1 |
| InChI | InChI=1S/C7H11N3OS/c1-3-8-7(11)10-6-4-9-5(2)12-6/h4H,3H2,1-2H3,(H2,8,10,11) |
| InChIKey | BPABADFNXNVQOX-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.25 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |