C8H10N2O2S — CID 130686013
N-(2-methyl-1,3-thiazol-5-yl)-4-oxobutanamide (PubChem CID 130686013) has the molecular formula C8H10N2O2S and a molecular weight of 198.25 g/mol. Its IUPAC name is N-(2-methyl-1,3-thiazol-5-yl)-4-oxobutanamide.
| Compound Name | N-(2-methyl-1,3-thiazol-5-yl)-4-oxobutanamide |
|---|---|
| PubChem CID | 130686013 |
| Molecular Formula | C8H10N2O2S |
| Molecular Weight | 198.25 g/mol |
| Exact Mass | 198.05 |
| IUPAC Name | N-(2-methyl-1,3-thiazol-5-yl)-4-oxobutanamide |
| SMILES | Cc1ncc(NC(=O)CCC=O)s1 |
| InChI | InChI=1S/C8H10N2O2S/c1-6-9-5-8(13-6)10-7(12)3-2-4-11/h4-5H,2-3H2,1H3,(H,10,12) |
| InChIKey | SLDJKLPINXIKCB-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.25 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|