About N-(2-methyl-1,3-thiazol-5-yl)-4-oxobutanamide
N-(2-methyl-1,3-thiazol-5-yl)-4-oxobutanamide (PubChem CID 130686013) has the molecular formula C8H10N2O2S
and a molecular weight of 198.25 g/mol. Its IUPAC name is N-(2-methyl-1,3-thiazol-5-yl)-4-oxobutanamide.
Molecular Properties
| Compound Name | N-(2-methyl-1,3-thiazol-5-yl)-4-oxobutanamide |
| PubChem CID | 130686013 |
| Molecular Formula | C8H10N2O2S |
| Molecular Weight | 198.25 g/mol |
| Exact Mass | 198.05 |
| IUPAC Name | N-(2-methyl-1,3-thiazol-5-yl)-4-oxobutanamide |
| SMILES | Cc1ncc(NC(=O)CCC=O)s1 |
| InChI | InChI=1S/C8H10N2O2S/c1-6-9-5-8(13-6)10-7(12)3-2-4-11/h4-5H,2-3H2,1H3,(H,10,12) |
| InChIKey | SLDJKLPINXIKCB-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.25 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-(2-methyl-1,3-thiazol-5-yl)-4-oxobutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-methyl-1,3-thiazol-5-yl)-4-oxobutanamide?
The IUPAC name of N-(2-methyl-1,3-thiazol-5-yl)-4-oxobutanamide (CID 130686013) is N-(2-methyl-1,3-thiazol-5-yl)-4-oxobutanamide.
What is the SMILES notation for N-(2-methyl-1,3-thiazol-5-yl)-4-oxobutanamide?
The canonical SMILES for N-(2-methyl-1,3-thiazol-5-yl)-4-oxobutanamide is Cc1ncc(NC(=O)CCC=O)s1.
What is the InChIKey of N-(2-methyl-1,3-thiazol-5-yl)-4-oxobutanamide?
The InChIKey is SLDJKLPINXIKCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O2S/c1-6-9-5-8(13-6)10-7(12)3-2-4-11/h4-5H,2-3H2,1H3,(H,10,12).
What are the key properties of N-(2-methyl-1,3-thiazol-5-yl)-4-oxobutanamide?
N-(2-methyl-1,3-thiazol-5-yl)-4-oxobutanamide has a molecular weight of 198.25 g/mol, XLogP of 1.37, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-methyl-1,3-thiazol-5-yl)-4-oxobutanamide is sourced from PubChem (CID 130686013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).