About N'-(2-methyl-1,3-thiazol-5-yl)propanediamide
N'-(2-methyl-1,3-thiazol-5-yl)propanediamide (PubChem CID 131203422) has the molecular formula C7H9N3O2S
and a molecular weight of 199.23 g/mol. Its IUPAC name is N'-(2-methyl-1,3-thiazol-5-yl)propanediamide.
Molecular Properties
| Compound Name | N'-(2-methyl-1,3-thiazol-5-yl)propanediamide |
| PubChem CID | 131203422 |
| Molecular Formula | C7H9N3O2S |
| Molecular Weight | 199.23 g/mol |
| Exact Mass | 199.04 |
| IUPAC Name | N'-(2-methyl-1,3-thiazol-5-yl)propanediamide |
| SMILES | Cc1ncc(NC(=O)CC(N)=O)s1 |
| InChI | InChI=1S/C7H9N3O2S/c1-4-9-3-7(13-4)10-6(12)2-5(8)11/h3H,2H2,1H3,(H2,8,11)(H,10,12) |
| InChIKey | AJBZIUURUDELKW-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.23 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze N'-(2-methyl-1,3-thiazol-5-yl)propanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2-methyl-1,3-thiazol-5-yl)propanediamide?
The IUPAC name of N'-(2-methyl-1,3-thiazol-5-yl)propanediamide (CID 131203422) is N'-(2-methyl-1,3-thiazol-5-yl)propanediamide.
What is the SMILES notation for N'-(2-methyl-1,3-thiazol-5-yl)propanediamide?
The canonical SMILES for N'-(2-methyl-1,3-thiazol-5-yl)propanediamide is Cc1ncc(NC(=O)CC(N)=O)s1.
What is the InChIKey of N'-(2-methyl-1,3-thiazol-5-yl)propanediamide?
The InChIKey is AJBZIUURUDELKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3O2S/c1-4-9-3-7(13-4)10-6(12)2-5(8)11/h3H,2H2,1H3,(H2,8,11)(H,10,12).
What are the key properties of N'-(2-methyl-1,3-thiazol-5-yl)propanediamide?
N'-(2-methyl-1,3-thiazol-5-yl)propanediamide has a molecular weight of 199.23 g/mol, XLogP of 0.27, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2-methyl-1,3-thiazol-5-yl)propanediamide is sourced from PubChem (CID 131203422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).