C8H10FN3O — CID 130685681
N'-(2-fluoro-4-pyridinyl)propanehydrazide (PubChem CID 130685681) has the molecular formula C8H10FN3O and a molecular weight of 183.19 g/mol. Its IUPAC name is N'-(2-fluoro-4-pyridinyl)propanehydrazide.
| Compound Name | N'-(2-fluoro-4-pyridinyl)propanehydrazide |
|---|---|
| PubChem CID | 130685681 |
| Molecular Formula | C8H10FN3O |
| Molecular Weight | 183.19 g/mol |
| Exact Mass | 183.08 |
| IUPAC Name | N'-(2-fluoro-4-pyridinyl)propanehydrazide |
| SMILES | CCC(=O)NNc1ccnc(F)c1 |
| InChI | InChI=1S/C8H10FN3O/c1-2-8(13)12-11-6-3-4-10-7(9)5-6/h3-5H,2H2,1H3,(H,10,11)(H,12,13) |
| InChIKey | MMNDXMYZLXCTQE-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.19 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|