C7H12N2S2 — CID 130689865
N-methyl-2-thia-5-azabicyclo[2.2.1]heptane-5-carbothioamide (PubChem CID 130689865) has the molecular formula C7H12N2S2 and a molecular weight of 188.32 g/mol. Its IUPAC name is N-methyl-2-thia-5-azabicyclo[2.2.1]heptane-5-carbothioamide.
| Compound Name | N-methyl-2-thia-5-azabicyclo[2.2.1]heptane-5-carbothioamide |
|---|---|
| PubChem CID | 130689865 |
| Molecular Formula | C7H12N2S2 |
| Molecular Weight | 188.32 g/mol |
| Exact Mass | 188.04 |
| IUPAC Name | N-methyl-2-thia-5-azabicyclo[2.2.1]heptane-5-carbothioamide |
| SMILES | CNC(=S)N1CC2CC1CS2 |
| InChI | InChI=1S/C7H12N2S2/c1-8-7(10)9-3-6-2-5(9)4-11-6/h5-6H,2-4H2,1H3,(H,8,10) |
| InChIKey | OZAIRWKXFZVXPA-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.32 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|