C8H11ClN2O2S — CID 131093282
N-(2-chloroacetyl)-2-thia-5-azabicyclo[2.2.1]heptane-5-carboxamide (PubChem CID 131093282) has the molecular formula C8H11ClN2O2S and a molecular weight of 234.71 g/mol. Its IUPAC name is N-(2-chloroacetyl)-2-thia-5-azabicyclo[2.2.1]heptane-5-carboxamide.
| Compound Name | N-(2-chloroacetyl)-2-thia-5-azabicyclo[2.2.1]heptane-5-carboxamide |
|---|---|
| PubChem CID | 131093282 |
| Molecular Formula | C8H11ClN2O2S |
| Molecular Weight | 234.71 g/mol |
| Exact Mass | 234.02 |
| IUPAC Name | N-(2-chloroacetyl)-2-thia-5-azabicyclo[2.2.1]heptane-5-carboxamide |
| SMILES | O=C(CCl)NC(=O)N1CC2CC1CS2 |
| InChI | InChI=1S/C8H11ClN2O2S/c9-2-7(12)10-8(13)11-3-6-1-5(11)4-14-6/h5-6H,1-4H2,(H,10,12,13) |
| InChIKey | KCNZHIBXBSBLAO-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.71 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|