C8H13N3 — CID 130692700
2-methyl-1-prop-2-enyl-3-prop-2-ynylguanidine (PubChem CID 130692700) has the molecular formula C8H13N3 and a molecular weight of 151.21 g/mol. Its IUPAC name is 2-methyl-1-prop-2-enyl-3-prop-2-ynylguanidine.
| Compound Name | 2-methyl-1-prop-2-enyl-3-prop-2-ynylguanidine |
|---|---|
| PubChem CID | 130692700 |
| Molecular Formula | C8H13N3 |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.11 |
| IUPAC Name | 2-methyl-1-prop-2-enyl-3-prop-2-ynylguanidine |
| SMILES | C#CCN/C(=N\C)NCC=C |
| InChI | InChI=1S/C8H13N3/c1-4-6-10-8(9-3)11-7-5-2/h1,5H,2,6-7H2,3H3,(H2,9,10,11) |
| InChIKey | HUPJPEXCZFNJST-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|