C8H13BrIN3 — CID 130615897
1-(2-bromoprop-2-enyl)-2-methyl-3-prop-2-ynylguanidine;hydroiodide (PubChem CID 130615897) has the molecular formula C8H13BrIN3 and a molecular weight of 358.02 g/mol. Its IUPAC name is 1-(2-bromoprop-2-enyl)-2-methyl-3-prop-2-ynylguanidine;hydroiodide.
| Compound Name | 1-(2-bromoprop-2-enyl)-2-methyl-3-prop-2-ynylguanidine;hydroiodide |
|---|---|
| PubChem CID | 130615897 |
| Molecular Formula | C8H13BrIN3 |
| Molecular Weight | 358.02 g/mol |
| Exact Mass | 356.93 |
| IUPAC Name | 1-(2-bromoprop-2-enyl)-2-methyl-3-prop-2-ynylguanidine;hydroiodide |
| SMILES | C#CCN/C(=N\C)NCC(=C)Br.I |
| InChI | InChI=1S/C8H12BrN3.HI/c1-4-5-11-8(10-3)12-6-7(2)9;/h1H,2,5-6H2,3H3,(H2,10,11,12);1H |
| InChIKey | XMCWMRHTWZMMKB-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.02 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|