C9H13F2NO — CID 130693652
1-(4,5-dimethyl-3,6-dihydro-2H-pyridin-1-yl)-2,2-difluoroethanone (PubChem CID 130693652) has the molecular formula C9H13F2NO and a molecular weight of 189.21 g/mol. Its IUPAC name is 1-(4,5-dimethyl-3,6-dihydro-2H-pyridin-1-yl)-2,2-difluoroethanone.
| Compound Name | 1-(4,5-dimethyl-3,6-dihydro-2H-pyridin-1-yl)-2,2-difluoroethanone |
|---|---|
| PubChem CID | 130693652 |
| Molecular Formula | C9H13F2NO |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.10 |
| IUPAC Name | 1-(4,5-dimethyl-3,6-dihydro-2H-pyridin-1-yl)-2,2-difluoroethanone |
| SMILES | CC1=C(C)CN(C(=O)C(F)F)CC1 |
| InChI | InChI=1S/C9H13F2NO/c1-6-3-4-12(5-7(6)2)9(13)8(10)11/h8H,3-5H2,1-2H3 |
| InChIKey | FDNQLERWSLPLAH-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|