C9H10BrNO4 — CID 130697664
5-bromo-N-[(3R,4S)-4-hydroxyoxolan-3-yl]furan-3-carboxamide (PubChem CID 130697664) has the molecular formula C9H10BrNO4 and a molecular weight of 276.09 g/mol. Its IUPAC name is 5-bromo-N-[(3R,4S)-4-hydroxyoxolan-3-yl]furan-3-carboxamide.
| Compound Name | 5-bromo-N-[(3R,4S)-4-hydroxyoxolan-3-yl]furan-3-carboxamide |
|---|---|
| PubChem CID | 130697664 |
| Molecular Formula | C9H10BrNO4 |
| Molecular Weight | 276.09 g/mol |
| Exact Mass | 274.98 |
| IUPAC Name | 5-bromo-N-[(3R,4S)-4-hydroxyoxolan-3-yl]furan-3-carboxamide |
| SMILES | O=C(N[C@@H]1COC[C@H]1O)c1coc(Br)c1 |
| InChI | InChI=1S/C9H10BrNO4/c10-8-1-5(2-15-8)9(13)11-6-3-14-4-7(6)12/h1-2,6-7,12H,3-4H2,(H,11,13)/t6-,7-/m1/s1 |
| InChIKey | XUBUDKFCGZSDKK-RNFRBKRXSA-N |
| XLogP | 0.53 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.09 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |