C9H12N2O3 — CID 141205463
N-(4-hydroxyoxolan-3-yl)-1H-pyrrole-3-carboxamide (PubChem CID 141205463) has the molecular formula C9H12N2O3 and a molecular weight of 196.21 g/mol. Its IUPAC name is N-(4-hydroxyoxolan-3-yl)-1H-pyrrole-3-carboxamide.
| Compound Name | N-(4-hydroxyoxolan-3-yl)-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 141205463 |
| Molecular Formula | C9H12N2O3 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | N-(4-hydroxyoxolan-3-yl)-1H-pyrrole-3-carboxamide |
| SMILES | O=C(NC1COCC1O)c1cc[nH]c1 |
| InChI | InChI=1S/C9H12N2O3/c12-8-5-14-4-7(8)11-9(13)6-1-2-10-3-6/h1-3,7-8,10,12H,4-5H2,(H,11,13) |
| InChIKey | WAHGYXMFZNKAQO-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |