C9H13NO2 — CID 130703469
(5-cyclobutyl-4-methyl-1,2-oxazol-3-yl)methanol (PubChem CID 130703469) has the molecular formula C9H13NO2 and a molecular weight of 167.21 g/mol. Its IUPAC name is (5-cyclobutyl-4-methyl-1,2-oxazol-3-yl)methanol.
| Compound Name | (5-cyclobutyl-4-methyl-1,2-oxazol-3-yl)methanol |
|---|---|
| PubChem CID | 130703469 |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | (5-cyclobutyl-4-methyl-1,2-oxazol-3-yl)methanol |
| SMILES | Cc1c(CO)noc1C1CCC1 |
| InChI | InChI=1S/C9H13NO2/c1-6-8(5-11)10-12-9(6)7-3-2-4-7/h7,11H,2-5H2,1H3 |
| InChIKey | MHZNIFDNUPZMEK-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |