C18H26N2O — CID 4080069
3-(4,5-dicyclohexyl-1,2-oxazol-3-yl)propanenitrile (PubChem CID 4080069) has the molecular formula C18H26N2O and a molecular weight of 286.42 g/mol. Its IUPAC name is 3-(4,5-dicyclohexyl-1,2-oxazol-3-yl)propanenitrile.
| Compound Name | 3-(4,5-dicyclohexyl-1,2-oxazol-3-yl)propanenitrile |
|---|---|
| PubChem CID | 4080069 |
| Molecular Formula | C18H26N2O |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | 3-(4,5-dicyclohexyl-1,2-oxazol-3-yl)propanenitrile |
| SMILES | N#CCCc1noc(C2CCCCC2)c1C1CCCCC1 |
| InChI | InChI=1S/C18H26N2O/c19-13-7-12-16-17(14-8-3-1-4-9-14)18(21-20-16)15-10-5-2-6-11-15/h14-15H,1-12H2 |
| InChIKey | LRADULMOYFNAHV-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 49.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |