C13H17NO2 — CID 130708638
(2S,3S)-3-(benzylamino)-3-methylpent-4-yne-1,2-diol (PubChem CID 130708638) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is (2S,3S)-3-(benzylamino)-3-methylpent-4-yne-1,2-diol.
| Compound Name | (2S,3S)-3-(benzylamino)-3-methylpent-4-yne-1,2-diol |
|---|---|
| PubChem CID | 130708638 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | (2S,3S)-3-(benzylamino)-3-methylpent-4-yne-1,2-diol |
| SMILES | C#C[C@](C)(NCc1ccccc1)[C@H](O)CO |
| InChI | InChI=1S/C13H17NO2/c1-3-13(2,12(16)10-15)14-9-11-7-5-4-6-8-11/h1,4-8,12,14-16H,9-10H2,2H3/t12-,13+/m1/s1 |
| InChIKey | GJNLCMPKYLTVCO-OLZOCXBDSA-N |
| XLogP | 0.52 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|