C9H14N4 — CID 130709441
2-[methyl-(5-propan-2-yl-1H-pyrazol-3-yl)amino]acetonitrile (PubChem CID 130709441) has the molecular formula C9H14N4 and a molecular weight of 178.24 g/mol. Its IUPAC name is 2-[methyl-(5-propan-2-yl-1H-pyrazol-3-yl)amino]acetonitrile.
| Compound Name | 2-[methyl-(5-propan-2-yl-1H-pyrazol-3-yl)amino]acetonitrile |
|---|---|
| PubChem CID | 130709441 |
| Molecular Formula | C9H14N4 |
| Molecular Weight | 178.24 g/mol |
| Exact Mass | 178.12 |
| IUPAC Name | 2-[methyl-(5-propan-2-yl-1H-pyrazol-3-yl)amino]acetonitrile |
| SMILES | CC(C)c1cc(N(C)CC#N)n[nH]1 |
| InChI | InChI=1S/C9H14N4/c1-7(2)8-6-9(12-11-8)13(3)5-4-10/h6-7H,5H2,1-3H3,(H,11,12) |
| InChIKey | QRVNXENSVXSMRS-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 55.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.24 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|