C13H23ClO — CID 130719358
2-(3-chloro-2-methylbutyl)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran (PubChem CID 130719358) has the molecular formula C13H23ClO and a molecular weight of 230.78 g/mol. Its IUPAC name is 2-(3-chloro-2-methylbutyl)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran.
| Compound Name | 2-(3-chloro-2-methylbutyl)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran |
|---|---|
| PubChem CID | 130719358 |
| Molecular Formula | C13H23ClO |
| Molecular Weight | 230.78 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | 2-(3-chloro-2-methylbutyl)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran |
| SMILES | CC(Cl)C(C)CC1CC2CCCCC2O1 |
| InChI | InChI=1S/C13H23ClO/c1-9(10(2)14)7-12-8-11-5-3-4-6-13(11)15-12/h9-13H,3-8H2,1-2H3 |
| InChIKey | SUSZFXHLRMZLGV-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.78 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|