C9H15BrO — CID 12857347
(3aR,7aS)-2-(bromomethyl)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran (PubChem CID 12857347) has the molecular formula C9H15BrO and a molecular weight of 219.12 g/mol. Its IUPAC name is (3aR,7aS)-2-(bromomethyl)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran.
| Compound Name | (3aR,7aS)-2-(bromomethyl)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran |
|---|---|
| PubChem CID | 12857347 |
| Molecular Formula | C9H15BrO |
| Molecular Weight | 219.12 g/mol |
| Exact Mass | 218.03 |
| IUPAC Name | (3aR,7aS)-2-(bromomethyl)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran |
| SMILES | BrCC1C[C@H]2CCCC[C@@H]2O1 |
| InChI | InChI=1S/C9H15BrO/c10-6-8-5-7-3-1-2-4-9(7)11-8/h7-9H,1-6H2/t7-,8?,9+/m1/s1 |
| InChIKey | ZTDZGIFCWDAJSS-NBXIYJJMSA-N |
| XLogP | 2.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.12 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|