C12H19NO3 — CID 154784408
3-(3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ylmethoxyimino)butan-2-one (PubChem CID 154784408) has the molecular formula C12H19NO3 and a molecular weight of 225.29 g/mol. Its IUPAC name is 3-(3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ylmethoxyimino)butan-2-one.
| Compound Name | 3-(3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ylmethoxyimino)butan-2-one |
|---|---|
| PubChem CID | 154784408 |
| Molecular Formula | C12H19NO3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | 3-(3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ylmethoxyimino)butan-2-one |
| SMILES | CC(=O)C(C)=NOCC1CC2CCCC2O1 |
| InChI | InChI=1S/C12H19NO3/c1-8(9(2)14)13-15-7-11-6-10-4-3-5-12(10)16-11/h10-12H,3-7H2,1-2H3 |
| InChIKey | GFJMXIZXQJPJKU-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|