C7H15N3O3S — CID 130729612
2-methyl-1-methylsulfonylpyrrolidine-2-carbohydrazide (PubChem CID 130729612) has the molecular formula C7H15N3O3S and a molecular weight of 221.28 g/mol. Its IUPAC name is 2-methyl-1-methylsulfonylpyrrolidine-2-carbohydrazide.
| Compound Name | 2-methyl-1-methylsulfonylpyrrolidine-2-carbohydrazide |
|---|---|
| PubChem CID | 130729612 |
| Molecular Formula | C7H15N3O3S |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.08 |
| IUPAC Name | 2-methyl-1-methylsulfonylpyrrolidine-2-carbohydrazide |
| SMILES | CC1(C(=O)NN)CCCN1S(C)(=O)=O |
| InChI | InChI=1S/C7H15N3O3S/c1-7(6(11)9-8)4-3-5-10(7)14(2,12)13/h3-5,8H2,1-2H3,(H,9,11) |
| InChIKey | RCAPXOBXFRDLJU-UHFFFAOYSA-N |
| XLogP | -1.21 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|