C8H17N3 — CID 130729853
1,2-dimethyl-3-(2-methylidenebutyl)guanidine (PubChem CID 130729853) has the molecular formula C8H17N3 and a molecular weight of 155.25 g/mol. Its IUPAC name is 1,2-dimethyl-3-(2-methylidenebutyl)guanidine.
| Compound Name | 1,2-dimethyl-3-(2-methylidenebutyl)guanidine |
|---|---|
| PubChem CID | 130729853 |
| Molecular Formula | C8H17N3 |
| Molecular Weight | 155.25 g/mol |
| Exact Mass | 155.14 |
| IUPAC Name | 1,2-dimethyl-3-(2-methylidenebutyl)guanidine |
| SMILES | C=C(CC)CN/C(=N/C)NC |
| InChI | InChI=1S/C8H17N3/c1-5-7(2)6-11-8(9-3)10-4/h2,5-6H2,1,3-4H3,(H2,9,10,11) |
| InChIKey | QHIVHKKPQLEJNO-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.25 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|