About 2-cyclopropyl-N-(2-methyl-1,3-thiazol-4-yl)acetamide
2-cyclopropyl-N-(2-methyl-1,3-thiazol-4-yl)acetamide (PubChem CID 130736068) has the molecular formula C9H12N2OS
and a molecular weight of 196.27 g/mol. Its IUPAC name is 2-cyclopropyl-N-(2-methyl-1,3-thiazol-4-yl)acetamide.
Molecular Properties
| Compound Name | 2-cyclopropyl-N-(2-methyl-1,3-thiazol-4-yl)acetamide |
| PubChem CID | 130736068 |
| Molecular Formula | C9H12N2OS |
| Molecular Weight | 196.27 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | 2-cyclopropyl-N-(2-methyl-1,3-thiazol-4-yl)acetamide |
| SMILES | Cc1nc(NC(=O)CC2CC2)cs1 |
| InChI | InChI=1S/C9H12N2OS/c1-6-10-8(5-13-6)11-9(12)4-7-2-3-7/h5,7H,2-4H2,1H3,(H,11,12) |
| InChIKey | MTZJSLCGMXBXSK-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.27 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-cyclopropyl-N-(2-methyl-1,3-thiazol-4-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropyl-N-(2-methyl-1,3-thiazol-4-yl)acetamide?
The IUPAC name of 2-cyclopropyl-N-(2-methyl-1,3-thiazol-4-yl)acetamide (CID 130736068) is 2-cyclopropyl-N-(2-methyl-1,3-thiazol-4-yl)acetamide.
What is the SMILES notation for 2-cyclopropyl-N-(2-methyl-1,3-thiazol-4-yl)acetamide?
The canonical SMILES for 2-cyclopropyl-N-(2-methyl-1,3-thiazol-4-yl)acetamide is Cc1nc(NC(=O)CC2CC2)cs1.
What is the InChIKey of 2-cyclopropyl-N-(2-methyl-1,3-thiazol-4-yl)acetamide?
The InChIKey is MTZJSLCGMXBXSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2OS/c1-6-10-8(5-13-6)11-9(12)4-7-2-3-7/h5,7H,2-4H2,1H3,(H,11,12).
What are the key properties of 2-cyclopropyl-N-(2-methyl-1,3-thiazol-4-yl)acetamide?
2-cyclopropyl-N-(2-methyl-1,3-thiazol-4-yl)acetamide has a molecular weight of 196.27 g/mol, XLogP of 2.19, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropyl-N-(2-methyl-1,3-thiazol-4-yl)acetamide is sourced from PubChem (CID 130736068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).