About 4,5-dichloro-1-methyl-3,6-dihydro-2H-pyridine
4,5-dichloro-1-methyl-3,6-dihydro-2H-pyridine (PubChem CID 130737113) has the molecular formula C6H9Cl2N
and a molecular weight of 166.05 g/mol. Its IUPAC name is 4,5-dichloro-1-methyl-3,6-dihydro-2H-pyridine.
Analyze 4,5-dichloro-1-methyl-3,6-dihydro-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dichloro-1-methyl-3,6-dihydro-2H-pyridine?
The IUPAC name of 4,5-dichloro-1-methyl-3,6-dihydro-2H-pyridine (CID 130737113) is 4,5-dichloro-1-methyl-3,6-dihydro-2H-pyridine.
What is the SMILES notation for 4,5-dichloro-1-methyl-3,6-dihydro-2H-pyridine?
The canonical SMILES for 4,5-dichloro-1-methyl-3,6-dihydro-2H-pyridine is CN1CCC(Cl)=C(Cl)C1.
What is the InChIKey of 4,5-dichloro-1-methyl-3,6-dihydro-2H-pyridine?
The InChIKey is IOESICAZDGJPSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9Cl2N/c1-9-3-2-5(7)6(8)4-9/h2-4H2,1H3.
What are the key properties of 4,5-dichloro-1-methyl-3,6-dihydro-2H-pyridine?
4,5-dichloro-1-methyl-3,6-dihydro-2H-pyridine has a molecular weight of 166.05 g/mol, XLogP of 2.01, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dichloro-1-methyl-3,6-dihydro-2H-pyridine is sourced from PubChem (CID 130737113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).