About 1,5-dimethyl-3,6-dihydro-2H-pyridin-4-amine;ethane
1,5-dimethyl-3,6-dihydro-2H-pyridin-4-amine;ethane (PubChem CID 170725640) has the molecular formula C9H20N2
and a molecular weight of 156.27 g/mol. Its IUPAC name is 1,5-dimethyl-3,6-dihydro-2H-pyridin-4-amine;ethane.
Analyze 1,5-dimethyl-3,6-dihydro-2H-pyridin-4-amine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-dimethyl-3,6-dihydro-2H-pyridin-4-amine;ethane?
The IUPAC name of 1,5-dimethyl-3,6-dihydro-2H-pyridin-4-amine;ethane (CID 170725640) is 1,5-dimethyl-3,6-dihydro-2H-pyridin-4-amine;ethane.
What is the SMILES notation for 1,5-dimethyl-3,6-dihydro-2H-pyridin-4-amine;ethane?
The canonical SMILES for 1,5-dimethyl-3,6-dihydro-2H-pyridin-4-amine;ethane is CC.CC1=C(N)CCN(C)C1.
What is the InChIKey of 1,5-dimethyl-3,6-dihydro-2H-pyridin-4-amine;ethane?
The InChIKey is QFOWBMJGHYUABT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2.C2H6/c1-6-5-9(2)4-3-7(6)8;1-2/h3-5,8H2,1-2H3;1-2H3.
What are the key properties of 1,5-dimethyl-3,6-dihydro-2H-pyridin-4-amine;ethane?
1,5-dimethyl-3,6-dihydro-2H-pyridin-4-amine;ethane has a molecular weight of 156.27 g/mol, XLogP of 1.58, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-dimethyl-3,6-dihydro-2H-pyridin-4-amine;ethane is sourced from PubChem (CID 170725640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).