C17H31N — CID 159857957
1,2,4-trimethylcyclohexene;1,4,5-trimethyl-3,6-dihydro-2H-pyridine (PubChem CID 159857957) has the molecular formula C17H31N and a molecular weight of 249.44 g/mol. Its IUPAC name is 1,2,4-trimethylcyclohexene;1,4,5-trimethyl-3,6-dihydro-2H-pyridine.
| Compound Name | 1,2,4-trimethylcyclohexene;1,4,5-trimethyl-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 159857957 |
| Molecular Formula | C17H31N |
| Molecular Weight | 249.44 g/mol |
| Exact Mass | 249.25 |
| IUPAC Name | 1,2,4-trimethylcyclohexene;1,4,5-trimethyl-3,6-dihydro-2H-pyridine |
| SMILES | CC1=C(C)CC(C)CC1.CC1=C(C)CN(C)CC1 |
| InChI | InChI=1S/C9H16.C8H15N/c1-7-4-5-8(2)9(3)6-7;1-7-4-5-9(3)6-8(7)2/h7H,4-6H2,1-3H3;4-6H2,1-3H3 |
| InChIKey | NQTRSLYNONAGEK-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.44 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|