C11H19N — CID 162883519
2,4,7-trimethyl-1,3,4,4a,5,6-hexahydrocyclopenta[c]pyridine (PubChem CID 162883519) has the molecular formula C11H19N and a molecular weight of 165.28 g/mol. Its IUPAC name is 2,4,7-trimethyl-1,3,4,4a,5,6-hexahydrocyclopenta[c]pyridine.
| Compound Name | 2,4,7-trimethyl-1,3,4,4a,5,6-hexahydrocyclopenta[c]pyridine |
|---|---|
| PubChem CID | 162883519 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | 2,4,7-trimethyl-1,3,4,4a,5,6-hexahydrocyclopenta[c]pyridine |
| SMILES | CC1=C2CN(C)CC(C)C2CC1 |
| InChI | InChI=1S/C11H19N/c1-8-4-5-10-9(2)6-12(3)7-11(8)10/h9-10H,4-7H2,1-3H3 |
| InChIKey | LYLJJPBJTDCXTN-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|