C11H20N2O — CID 142187739
(8S)-1,6,8-trimethyl-3,3a,5,7,8,8a-hexahydro-2H-pyrrolo[2,3-d]azepin-4-one (PubChem CID 142187739) has the molecular formula C11H20N2O and a molecular weight of 196.29 g/mol. Its IUPAC name is (8S)-1,6,8-trimethyl-3,3a,5,7,8,8a-hexahydro-2H-pyrrolo[2,3-d]azepin-4-one.
| Compound Name | (8S)-1,6,8-trimethyl-3,3a,5,7,8,8a-hexahydro-2H-pyrrolo[2,3-d]azepin-4-one |
|---|---|
| PubChem CID | 142187739 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | (8S)-1,6,8-trimethyl-3,3a,5,7,8,8a-hexahydro-2H-pyrrolo[2,3-d]azepin-4-one |
| SMILES | C[C@H]1CN(C)CC(=O)C2CCN(C)C21 |
| InChI | InChI=1S/C11H20N2O/c1-8-6-12(2)7-10(14)9-4-5-13(3)11(8)9/h8-9,11H,4-7H2,1-3H3/t8-,9?,11?/m0/s1 |
| InChIKey | MGVDGMAHXVSXJK-SILCLGDVSA-N |
| XLogP | 0.46 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |