C7H12N2O3 — CID 130756844
(7R,8R,8aR)-7,8-dihydroxy-2,3,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-4-one (PubChem CID 130756844) has the molecular formula C7H12N2O3 and a molecular weight of 172.18 g/mol. Its IUPAC name is (7R,8R,8aR)-7,8-dihydroxy-2,3,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-4-one.
| Compound Name | (7R,8R,8aR)-7,8-dihydroxy-2,3,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-4-one |
|---|---|
| PubChem CID | 130756844 |
| Molecular Formula | C7H12N2O3 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.08 |
| IUPAC Name | (7R,8R,8aR)-7,8-dihydroxy-2,3,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-4-one |
| SMILES | O=C1CNC[C@@H]2[C@@H](O)[C@H](O)CN12 |
| InChI | InChI=1S/C7H12N2O3/c10-5-3-9-4(7(5)12)1-8-2-6(9)11/h4-5,7-8,10,12H,1-3H2/t4-,5-,7-/m1/s1 |
| InChIKey | ABEVVUQPNGOYGU-WYDQCIBASA-N |
| XLogP | -2.48 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | -2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |