C10H18O2 — CID 130762611
2-[(1S,4R)-4-(2-hydroxyethyl)-4-methylcyclobut-2-en-1-yl]propan-2-ol (PubChem CID 130762611) has the molecular formula C10H18O2 and a molecular weight of 170.25 g/mol. Its IUPAC name is 2-[(1S,4R)-4-(2-hydroxyethyl)-4-methylcyclobut-2-en-1-yl]propan-2-ol.
| Compound Name | 2-[(1S,4R)-4-(2-hydroxyethyl)-4-methylcyclobut-2-en-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 130762611 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | 2-[(1S,4R)-4-(2-hydroxyethyl)-4-methylcyclobut-2-en-1-yl]propan-2-ol |
| SMILES | CC(C)(O)[C@H]1C=C[C@@]1(C)CCO |
| InChI | InChI=1S/C10H18O2/c1-9(2,12)8-4-5-10(8,3)6-7-11/h4-5,8,11-12H,6-7H2,1-3H3/t8-,10+/m1/s1 |
| InChIKey | IQDIBMDDNOKWGB-SCZZXKLOSA-N |
| XLogP | 1.33 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|