C11H18FNO — CID 130765995
1-(4,5-dimethyl-3,6-dihydro-2H-pyridin-1-yl)-2-fluoro-2-methylpropan-1-one (PubChem CID 130765995) has the molecular formula C11H18FNO and a molecular weight of 199.27 g/mol. Its IUPAC name is 1-(4,5-dimethyl-3,6-dihydro-2H-pyridin-1-yl)-2-fluoro-2-methylpropan-1-one.
| Compound Name | 1-(4,5-dimethyl-3,6-dihydro-2H-pyridin-1-yl)-2-fluoro-2-methylpropan-1-one |
|---|---|
| PubChem CID | 130765995 |
| Molecular Formula | C11H18FNO |
| Molecular Weight | 199.27 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | 1-(4,5-dimethyl-3,6-dihydro-2H-pyridin-1-yl)-2-fluoro-2-methylpropan-1-one |
| SMILES | CC1=C(C)CN(C(=O)C(C)(C)F)CC1 |
| InChI | InChI=1S/C11H18FNO/c1-8-5-6-13(7-9(8)2)10(14)11(3,4)12/h5-7H2,1-4H3 |
| InChIKey | JWCDDPCIQFWFOH-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.27 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|