C8H15ClN2 — CID 130774969
3-(chloromethyl)-1,2,3,4,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazine (PubChem CID 130774969) has the molecular formula C8H15ClN2 and a molecular weight of 174.67 g/mol. Its IUPAC name is 3-(chloromethyl)-1,2,3,4,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazine.
| Compound Name | 3-(chloromethyl)-1,2,3,4,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 130774969 |
| Molecular Formula | C8H15ClN2 |
| Molecular Weight | 174.67 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | 3-(chloromethyl)-1,2,3,4,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazine |
| SMILES | ClCC1CN2CCCC2CN1 |
| InChI | InChI=1S/C8H15ClN2/c9-4-7-6-11-3-1-2-8(11)5-10-7/h7-8,10H,1-6H2 |
| InChIKey | QSWYRFSAYIQXJJ-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.67 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|