C8H16N2OS — CID 130921167
[(7R,9aS)-1,3,4,6,7,8,9,9a-octahydropyrazino[2,1-c][1,4]thiazin-7-yl]methanol (PubChem CID 130921167) has the molecular formula C8H16N2OS and a molecular weight of 188.30 g/mol. Its IUPAC name is [(7R,9aS)-1,3,4,6,7,8,9,9a-octahydropyrazino[2,1-c][1,4]thiazin-7-yl]methanol.
| Compound Name | [(7R,9aS)-1,3,4,6,7,8,9,9a-octahydropyrazino[2,1-c][1,4]thiazin-7-yl]methanol |
|---|---|
| PubChem CID | 130921167 |
| Molecular Formula | C8H16N2OS |
| Molecular Weight | 188.30 g/mol |
| Exact Mass | 188.10 |
| IUPAC Name | [(7R,9aS)-1,3,4,6,7,8,9,9a-octahydropyrazino[2,1-c][1,4]thiazin-7-yl]methanol |
| SMILES | OC[C@H]1CN2CCSC[C@@H]2CN1 |
| InChI | InChI=1S/C8H16N2OS/c11-5-7-4-10-1-2-12-6-8(10)3-9-7/h7-9,11H,1-6H2/t7-,8+/m1/s1 |
| InChIKey | GVGCIXJCWXCESS-SFYZADRCSA-N |
| XLogP | -0.63 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.30 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |