C9H16N2O2S — CID 131018943
methyl (7R,9aS)-1,3,4,6,7,8,9,9a-octahydropyrazino[2,1-c][1,4]thiazine-7-carboxylate (PubChem CID 131018943) has the molecular formula C9H16N2O2S and a molecular weight of 216.31 g/mol. Its IUPAC name is methyl (7R,9aS)-1,3,4,6,7,8,9,9a-octahydropyrazino[2,1-c][1,4]thiazine-7-carboxylate.
| Compound Name | methyl (7R,9aS)-1,3,4,6,7,8,9,9a-octahydropyrazino[2,1-c][1,4]thiazine-7-carboxylate |
|---|---|
| PubChem CID | 131018943 |
| Molecular Formula | C9H16N2O2S |
| Molecular Weight | 216.31 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | methyl (7R,9aS)-1,3,4,6,7,8,9,9a-octahydropyrazino[2,1-c][1,4]thiazine-7-carboxylate |
| SMILES | COC(=O)[C@H]1CN2CCSC[C@@H]2CN1 |
| InChI | InChI=1S/C9H16N2O2S/c1-13-9(12)8-5-11-2-3-14-6-7(11)4-10-8/h7-8,10H,2-6H2,1H3/t7-,8+/m0/s1 |
| InChIKey | KKIHLUSAADWDBX-JGVFFNPUSA-N |
| XLogP | -0.45 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.31 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |